C13H12N4O4S — CID 31814497
N-[3-(carbamoylamino)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 31814497) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 31814497 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)Nc2cccc(NC(N)=O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O4S/c1-7-10(17(20)21)6-11(22-7)12(18)15-8-3-2-4-9(5-8)16-13(14)19/h2-6H,1H3,(H,15,18)(H3,14,16,19) |
| InChIKey | KEKNFRMFWLUYAL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|