C24H17ClN2O5 — CID 55726255
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 55726255) has the molecular formula C24H17ClN2O5 and a molecular weight of 448.86 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
|---|---|
| PubChem CID | 55726255 |
| Molecular Formula | C24H17ClN2O5 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C24H17ClN2O5/c25-18-13-15(26-22(28)12-14-5-8-20-21(11-14)32-10-9-31-20)6-7-19(18)27-23(29)16-3-1-2-4-17(16)24(27)30/h1-8,11,13H,9-10,12H2,(H,26,28) |
| InChIKey | RWLSTXKUHJWXLL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|