C17H15Cl2NO — CID 3380579
2-(2,6-dichlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 3380579) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)acetamide |
|---|---|
| PubChem CID | 3380579 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H15Cl2NO/c18-15-5-2-6-16(19)14(15)10-17(21)20-13-8-7-11-3-1-4-12(11)9-13/h2,5-9H,1,3-4,10H2,(H,20,21) |
| InChIKey | XHPOWMORQQHWER-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |