C17H15N3O3S — CID 31669164
N-(4-acetamidophenyl)-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 31669164) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 31669164 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)Cc2csc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11(21)18-12-4-6-13(7-5-12)19-16(22)9-14-10-24-17(20-14)15-3-2-8-23-15/h2-8,10H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | DILPMFIBSLPASV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |