C27H31N3O — CID 27050656
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-phenylphenyl)acetamide (PubChem CID 27050656) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 27050656 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cc3ccc(-c4ccccc4)cc3)cc2C)CC1 |
| InChI | InChI=1S/C27H31N3O/c1-3-29-15-17-30(18-16-29)26-14-13-25(19-21(26)2)28-27(31)20-22-9-11-24(12-10-22)23-7-5-4-6-8-23/h4-14,19H,3,15-18,20H2,1-2H3,(H,28,31) |
| InChIKey | ARZVLGCYHQISJC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|