C24H29N5O2 — CID 36592874
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide (PubChem CID 36592874) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 36592874 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCc3nnc(-c4ccccc4)o3)cc2C)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-3-28-13-15-29(16-14-28)21-10-9-20(17-18(21)2)25-22(30)11-12-23-26-27-24(31-23)19-7-5-4-6-8-19/h4-10,17H,3,11-16H2,1-2H3,(H,25,30) |
| InChIKey | YKUHRRBOWFMMNN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|