C24H28N4O2 — CID 24525445
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 24525445) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 24525445 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3nc(-c4ccccc4)oc3C)cc2C)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-4-27-12-14-28(15-13-27)21-11-10-20(16-17(21)2)25-23(29)22-18(3)30-24(26-22)19-8-6-5-7-9-19/h5-11,16H,4,12-15H2,1-3H3,(H,25,29) |
| InChIKey | NRQTYOMLTHTVFM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|