C24H33N5O2 — CID 46430491
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 46430491) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 46430491 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cccc(NC(=O)NC(C)C)c3)cc2C)CC1 |
| InChI | InChI=1S/C24H33N5O2/c1-5-28-11-13-29(14-12-28)22-10-9-21(15-18(22)4)26-23(30)19-7-6-8-20(16-19)27-24(31)25-17(2)3/h6-10,15-17H,5,11-14H2,1-4H3,(H,26,30)(H2,25,27,31) |
| InChIKey | JQJAFVQUUHVOOG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|