C23H30N4O2 — CID 33237022
N-(3-methyl-4-pyrrolidin-1-ylphenyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide (PubChem CID 33237022) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(3-methyl-4-pyrrolidin-1-ylphenyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide.
| Compound Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 33237022 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-4-[(propan-2-ylcarbamoylamino)methyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(CNC(=O)NC(C)C)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C23H30N4O2/c1-16(2)25-23(29)24-15-18-6-8-19(9-7-18)22(28)26-20-10-11-21(17(3)14-20)27-12-4-5-13-27/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,26,28)(H2,24,25,29) |
| InChIKey | ANCLXMXLEGUDNX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|