C24H33ClN4O3S — CID 27298805
4-chloro-3-(diethylsulfamoyl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide (PubChem CID 27298805) has the molecular formula C24H33ClN4O3S and a molecular weight of 493.07 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide |
|---|---|
| PubChem CID | 27298805 |
| Molecular Formula | C24H33ClN4O3S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(Cl)c(S(=O)(=O)N(CC)CC)c3)cc2C)CC1 |
| InChI | InChI=1S/C24H33ClN4O3S/c1-5-27-12-14-28(15-13-27)22-11-9-20(16-18(22)4)26-24(30)19-8-10-21(25)23(17-19)33(31,32)29(6-2)7-3/h8-11,16-17H,5-7,12-15H2,1-4H3,(H,26,30) |
| InChIKey | ANNAGTVSKAROSE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|