C24H31FN4O3S — CID 37023704
N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 37023704) has the molecular formula C24H31FN4O3S and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 37023704 |
| Molecular Formula | C24H31FN4O3S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-4-fluoro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(F)c(S(=O)(=O)N4CCCC4)c3)cc2C)CC1 |
| InChI | InChI=1S/C24H31FN4O3S/c1-3-27-12-14-28(15-13-27)22-9-7-20(16-18(22)2)26-24(30)19-6-8-21(25)23(17-19)33(31,32)29-10-4-5-11-29/h6-9,16-17H,3-5,10-15H2,1-2H3,(H,26,30) |
| InChIKey | SLVLDTXBCFYFKB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|