C25H27ClFN3O4S — CID 126479373
3-(4-ethylpiperazin-1-yl)sulfonyl-4-fluoro-N-(4-phenoxyphenyl)benzamide;hydrochloride (PubChem CID 126479373) has the molecular formula C25H27ClFN3O4S and a molecular weight of 520.03 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)sulfonyl-4-fluoro-N-(4-phenoxyphenyl)benzamide;hydrochloride.
| Compound Name | 3-(4-ethylpiperazin-1-yl)sulfonyl-4-fluoro-N-(4-phenoxyphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 126479373 |
| Molecular Formula | C25H27ClFN3O4S |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)sulfonyl-4-fluoro-N-(4-phenoxyphenyl)benzamide;hydrochloride |
| SMILES | CCN1CCN(S(=O)(=O)c2cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)ccc2F)CC1.Cl |
| InChI | InChI=1S/C25H26FN3O4S.ClH/c1-2-28-14-16-29(17-15-28)34(31,32)24-18-19(8-13-23(24)26)25(30)27-20-9-11-22(12-10-20)33-21-6-4-3-5-7-21;/h3-13,18H,2,14-17H2,1H3,(H,27,30);1H |
| InChIKey | GGFLEOSVZYKEPU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |