C27H23FN2O4S — CID 3407821
4-fluoro-3-[(4-methylphenyl)methylsulfamoyl]-N-(4-phenoxyphenyl)benzamide (PubChem CID 3407821) has the molecular formula C27H23FN2O4S and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-fluoro-3-[(4-methylphenyl)methylsulfamoyl]-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 4-fluoro-3-[(4-methylphenyl)methylsulfamoyl]-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3407821 |
| Molecular Formula | C27H23FN2O4S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-fluoro-3-[(4-methylphenyl)methylsulfamoyl]-N-(4-phenoxyphenyl)benzamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)ccc2F)cc1 |
| InChI | InChI=1S/C27H23FN2O4S/c1-19-7-9-20(10-8-19)18-29-35(32,33)26-17-21(11-16-25(26)28)27(31)30-22-12-14-24(15-13-22)34-23-5-3-2-4-6-23/h2-17,29H,18H2,1H3,(H,30,31) |
| InChIKey | HEWHDAQIWOYDFL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |