C24H29F2N3O3 — CID 24525515
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide (PubChem CID 24525515) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24525515 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3cccc(OC)c3OC(F)F)cc2C)CC1 |
| InChI | InChI=1S/C24H29F2N3O3/c1-4-28-12-14-29(15-13-28)20-10-9-19(16-17(20)2)27-22(30)11-8-18-6-5-7-21(31-3)23(18)32-24(25)26/h5-11,16,24H,4,12-15H2,1-3H3,(H,27,30)/b11-8+ |
| InChIKey | IQBROJZCKBTUAZ-DHZHZOJOSA-N |
| XLogP | 4.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|