C22H28F2N4O2 — CID 47033178
1-[[2-(difluoromethoxy)phenyl]methyl]-3-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]urea (PubChem CID 47033178) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]urea.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]urea |
|---|---|
| PubChem CID | 47033178 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-3-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]urea |
| SMILES | CCN1CCN(c2ccc(NC(=O)NCc3ccccc3OC(F)F)cc2C)CC1 |
| InChI | InChI=1S/C22H28F2N4O2/c1-3-27-10-12-28(13-11-27)19-9-8-18(14-16(19)2)26-22(29)25-15-17-6-4-5-7-20(17)30-21(23)24/h4-9,14,21H,3,10-13,15H2,1-2H3,(H2,25,26,29) |
| InChIKey | AAIYOUZAGOCWJZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|