C20H22F2N2O2 — CID 33236991
2-[4-(difluoromethoxy)phenyl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 33236991) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 33236991 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-N-(3-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccc(OC(F)F)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-14-12-16(6-9-18(14)24-10-2-3-11-24)23-19(25)13-15-4-7-17(8-5-15)26-20(21)22/h4-9,12,20H,2-3,10-11,13H2,1H3,(H,23,25) |
| InChIKey | BWQUKIVRMIIXMK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|