C21H22F2N2O3 — CID 47089557
2-[4-(difluoromethoxy)phenyl]-N-[2-methyl-3-(pyrrolidine-1-carbonyl)phenyl]acetamide (PubChem CID 47089557) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-N-[2-methyl-3-(pyrrolidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-N-[2-methyl-3-(pyrrolidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47089557 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-N-[2-methyl-3-(pyrrolidine-1-carbonyl)phenyl]acetamide |
| SMILES | Cc1c(NC(=O)Cc2ccc(OC(F)F)cc2)cccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H22F2N2O3/c1-14-17(20(27)25-11-2-3-12-25)5-4-6-18(14)24-19(26)13-15-7-9-16(10-8-15)28-21(22)23/h4-10,21H,2-3,11-13H2,1H3,(H,24,26) |
| InChIKey | OJJAVLIHKCCEGD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |