C17H16NO4- — CID 4176095
3-[[2-(4-methoxyphenyl)acetyl]amino]-2-methylbenzoate (PubChem CID 4176095) has the molecular formula C17H16NO4- and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-[[2-(4-methoxyphenyl)acetyl]amino]-2-methylbenzoate.
| Compound Name | 3-[[2-(4-methoxyphenyl)acetyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 4176095 |
| Molecular Formula | C17H16NO4- |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[[2-(4-methoxyphenyl)acetyl]amino]-2-methylbenzoate |
| SMILES | COc1ccc(CC(=O)Nc2cccc(C(=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-11-14(17(20)21)4-3-5-15(11)18-16(19)10-12-6-8-13(22-2)9-7-12/h3-9H,10H2,1-2H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | CJWQGASYHQDZIX-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |