C15H14NO3- — CID 3280708
2-[(4-methoxyphenyl)methylamino]benzoate (PubChem CID 3280708) has the molecular formula C15H14NO3- and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylamino]benzoate.
| Compound Name | 2-[(4-methoxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 3280708 |
| Molecular Formula | C15H14NO3- |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylamino]benzoate |
| SMILES | COc1ccc(CNc2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H15NO3/c1-19-12-8-6-11(7-9-12)10-16-14-5-3-2-4-13(14)15(17)18/h2-9,16H,10H2,1H3,(H,17,18)/p-1 |
| InChIKey | ZXKZQGYJUYYZAD-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |