C23H19F5N2O2 — CID 16577157
N-[2-(4-methoxyphenyl)ethyl]-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide (PubChem CID 16577157) has the molecular formula C23H19F5N2O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 16577157 |
| Molecular Formula | C23H19F5N2O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2NCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H19F5N2O2/c1-32-14-8-6-13(7-9-14)10-11-29-23(31)15-4-2-3-5-17(15)30-12-16-18(24)20(26)22(28)21(27)19(16)25/h2-9,30H,10-12H2,1H3,(H,29,31) |
| InChIKey | GZULBPOICDFYMN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|