C25H26N4O5 — CID 4882581
N-[2-(4-methoxyphenyl)ethyl]-2-[[2-(2-methyl-3-nitroanilino)-2-oxoethyl]amino]benzamide (PubChem CID 4882581) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[[2-(2-methyl-3-nitroanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[[2-(2-methyl-3-nitroanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 4882581 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[[2-(2-methyl-3-nitroanilino)-2-oxoethyl]amino]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2NCC(=O)Nc2cccc([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C25H26N4O5/c1-17-21(8-5-9-23(17)29(32)33)28-24(30)16-27-22-7-4-3-6-20(22)25(31)26-15-14-18-10-12-19(34-2)13-11-18/h3-13,27H,14-16H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | JNZLLAJEGIYZRW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|