C17H17N3O5 — CID 7585365
N-[2-(4-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide (PubChem CID 7585365) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 7585365 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N3O5/c1-25-13-8-6-12(7-9-13)10-11-18-16(21)17(22)19-14-4-2-3-5-15(14)20(23)24/h2-9H,10-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | FMAPMFHCPNAKFX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|