C18H19N3O6 — CID 90598230
N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide (PubChem CID 90598230) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide.
| Compound Name | N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 90598230 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-N'-(2-nitrophenyl)oxamide |
| SMILES | COc1ccccc1C(CNC(=O)C(=O)Nc1ccccc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C18H19N3O6/c1-26-15-10-6-3-7-12(15)16(27-2)11-19-17(22)18(23)20-13-8-4-5-9-14(13)21(24)25/h3-10,16H,11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | USTUQQZSBWFRQM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|