C18H16ClN3O3 — CID 90623942
N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(2-cyanophenyl)oxamide (PubChem CID 90623942) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(2-cyanophenyl)oxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(2-cyanophenyl)oxamide |
|---|---|
| PubChem CID | 90623942 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(2-cyanophenyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccccc1C#N)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN3O3/c1-25-16(13-7-3-4-8-14(13)19)11-21-17(23)18(24)22-15-9-5-2-6-12(15)10-20/h2-9,16H,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | UHRBBLHYUHQPLE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|