C18H25ClN2O3 — CID 90623941
N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cycloheptyloxamide (PubChem CID 90623941) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cycloheptyloxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cycloheptyloxamide |
|---|---|
| PubChem CID | 90623941 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cycloheptyloxamide |
| SMILES | COC(CNC(=O)C(=O)NC1CCCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C18H25ClN2O3/c1-24-16(14-10-6-7-11-15(14)19)12-20-17(22)18(23)21-13-8-4-2-3-5-9-13/h6-7,10-11,13,16H,2-5,8-9,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZWBXRWOZDLBUNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|