C19H21ClN2O3 — CID 90623943
N'-[2-(2-chlorophenyl)-2-methoxyethyl]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 90623943) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-methoxyethyl]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-methoxyethyl]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 90623943 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-methoxyethyl]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)NCc1ccc(C)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN2O3/c1-13-7-9-14(10-8-13)11-21-18(23)19(24)22-12-17(25-2)15-5-3-4-6-16(15)20/h3-10,17H,11-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | AHYQVSDQTFTIDN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|