C17H23ClN2O3 — CID 90623934
N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cyclohexyloxamide (PubChem CID 90623934) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cyclohexyloxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cyclohexyloxamide |
|---|---|
| PubChem CID | 90623934 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-cyclohexyloxamide |
| SMILES | COC(CNC(=O)C(=O)NC1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN2O3/c1-23-15(13-9-5-6-10-14(13)18)11-19-16(21)17(22)20-12-7-3-2-4-8-12/h5-6,9-10,12,15H,2-4,7-8,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | JNKDZSRQNXCNSE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|