C18H16ClF3N2O3 — CID 90623997
N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 90623997) has the molecular formula C18H16ClF3N2O3 and a molecular weight of 400.78 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 90623997 |
| Molecular Formula | C18H16ClF3N2O3 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClF3N2O3/c1-27-15(13-7-2-3-8-14(13)19)10-23-16(25)17(26)24-12-6-4-5-11(9-12)18(20,21)22/h2-9,15H,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | LYXDMACIJNNJBY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|