C21H24ClN3O5S — CID 90624004
N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide (PubChem CID 90624004) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
|---|---|
| PubChem CID | 90624004 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccc2c(c1)N(S(C)(=O)=O)CCC2)c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClN3O5S/c1-30-19(16-7-3-4-8-17(16)22)13-23-20(26)21(27)24-15-10-9-14-6-5-11-25(18(14)12-15)31(2,28)29/h3-4,7-10,12,19H,5-6,11,13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | UIBUUIQNZQHJEZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|