C23H29N3O5S — CID 90599777
N-(2-methoxy-2-phenylbutyl)-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide (PubChem CID 90599777) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-(2-methoxy-2-phenylbutyl)-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide.
| Compound Name | N-(2-methoxy-2-phenylbutyl)-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
|---|---|
| PubChem CID | 90599777 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-(2-methoxy-2-phenylbutyl)-N'-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)oxamide |
| SMILES | CCC(CNC(=O)C(=O)Nc1ccc2c(c1)N(S(C)(=O)=O)CCC2)(OC)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O5S/c1-4-23(31-2,18-10-6-5-7-11-18)16-24-21(27)22(28)25-19-13-12-17-9-8-14-26(20(17)15-19)32(3,29)30/h5-7,10-13,15H,4,8-9,14,16H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | NVOWWSVRKHNXMC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|