C13H15ClF3NO2 — CID 90623820
N-[2-(2-chlorophenyl)-2-methoxyethyl]-4,4,4-trifluorobutanamide (PubChem CID 90623820) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 90623820 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-4,4,4-trifluorobutanamide |
| SMILES | COC(CNC(=O)CCC(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C13H15ClF3NO2/c1-20-11(9-4-2-3-5-10(9)14)8-18-12(19)6-7-13(15,16)17/h2-5,11H,6-8H2,1H3,(H,18,19) |
| InChIKey | WESFRQQLJKASOA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |