C18H19BrClNO2 — CID 99876162
3-(2-bromophenyl)-N-[(2S)-2-(2-chlorophenyl)-2-methoxyethyl]propanamide (PubChem CID 99876162) has the molecular formula C18H19BrClNO2 and a molecular weight of 396.71 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[(2S)-2-(2-chlorophenyl)-2-methoxyethyl]propanamide.
| Compound Name | 3-(2-bromophenyl)-N-[(2S)-2-(2-chlorophenyl)-2-methoxyethyl]propanamide |
|---|---|
| PubChem CID | 99876162 |
| Molecular Formula | C18H19BrClNO2 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 3-(2-bromophenyl)-N-[(2S)-2-(2-chlorophenyl)-2-methoxyethyl]propanamide |
| SMILES | CO[C@H](CNC(=O)CCc1ccccc1Br)c1ccccc1Cl |
| InChI | InChI=1S/C18H19BrClNO2/c1-23-17(14-7-3-5-9-16(14)20)12-21-18(22)11-10-13-6-2-4-8-15(13)19/h2-9,17H,10-12H2,1H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | BSFFQZGKXRGJCX-QGZVFWFLSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |