C24H24ClNO2 — CID 121145441
N-[2-(2-chlorophenyl)-2-methoxyethyl]-3,3-diphenylpropanamide (PubChem CID 121145441) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-methoxyethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 121145441 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-methoxyethyl]-3,3-diphenylpropanamide |
| SMILES | COC(CNC(=O)CC(c1ccccc1)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C24H24ClNO2/c1-28-23(20-14-8-9-15-22(20)25)17-26-24(27)16-21(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,21,23H,16-17H2,1H3,(H,26,27) |
| InChIKey | GQDGVYGWBQLNDC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |