C23H25NO2S — CID 90598426
N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-3,3-diphenylpropanamide (PubChem CID 90598426) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 90598426 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-3,3-diphenylpropanamide |
| SMILES | COC(CNC(=O)CC(c1ccccc1)c1ccccc1)c1ccc(C)s1 |
| InChI | InChI=1S/C23H25NO2S/c1-17-13-14-22(27-17)21(26-2)16-24-23(25)15-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,20-21H,15-16H2,1-2H3,(H,24,25) |
| InChIKey | BXTCAGFDIGPDLD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |