C15H15N3O5S — CID 90584146
N-(2-methoxy-2-thiophen-3-ylethyl)-N'-(2-nitrophenyl)oxamide (PubChem CID 90584146) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-(2-methoxy-2-thiophen-3-ylethyl)-N'-(2-nitrophenyl)oxamide.
| Compound Name | N-(2-methoxy-2-thiophen-3-ylethyl)-N'-(2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 90584146 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-(2-methoxy-2-thiophen-3-ylethyl)-N'-(2-nitrophenyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccccc1[N+](=O)[O-])c1ccsc1 |
| InChI | InChI=1S/C15H15N3O5S/c1-23-13(10-6-7-24-9-10)8-16-14(19)15(20)17-11-4-2-3-5-12(11)18(21)22/h2-7,9,13H,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | JPIXTUCIMBMOJN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|