C16H15F3N2O4S — CID 90584171
N-(2-methoxy-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide (PubChem CID 90584171) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is N-(2-methoxy-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide.
| Compound Name | N-(2-methoxy-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 90584171 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(2-methoxy-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccc(OC(F)(F)F)cc1)c1ccsc1 |
| InChI | InChI=1S/C16H15F3N2O4S/c1-24-13(10-6-7-26-9-10)8-20-14(22)15(23)21-11-2-4-12(5-3-11)25-16(17,18)19/h2-7,9,13H,8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ROKBZHWRBRTJHK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|