C16H17ClN2O3S — CID 97414515
N-[(4-chlorophenyl)methyl]-N'-[(2R)-2-methoxy-2-thiophen-3-ylethyl]oxamide (PubChem CID 97414515) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N'-[(2R)-2-methoxy-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N'-[(2R)-2-methoxy-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 97414515 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N'-[(2R)-2-methoxy-2-thiophen-3-ylethyl]oxamide |
| SMILES | CO[C@@H](CNC(=O)C(=O)NCc1ccc(Cl)cc1)c1ccsc1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-22-14(12-6-7-23-10-12)9-19-16(21)15(20)18-8-11-2-4-13(17)5-3-11/h2-7,10,14H,8-9H2,1H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | NACQMQBUZGZXLA-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|