C10H15NO3S — CID 71804729
ethyl N-(2-methoxy-2-thiophen-3-ylethyl)carbamate (PubChem CID 71804729) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is ethyl N-(2-methoxy-2-thiophen-3-ylethyl)carbamate.
| Compound Name | ethyl N-(2-methoxy-2-thiophen-3-ylethyl)carbamate |
|---|---|
| PubChem CID | 71804729 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | ethyl N-(2-methoxy-2-thiophen-3-ylethyl)carbamate |
| SMILES | CCOC(=O)NCC(OC)c1ccsc1 |
| InChI | InChI=1S/C10H15NO3S/c1-3-14-10(12)11-6-9(13-2)8-4-5-15-7-8/h4-5,7,9H,3,6H2,1-2H3,(H,11,12) |
| InChIKey | BQTUIXISRGZEAL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |