C12H12BrNO2S2 — CID 97427365
4-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]thiophene-2-carboxamide (PubChem CID 97427365) has the molecular formula C12H12BrNO2S2 and a molecular weight of 346.27 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97427365 |
| Molecular Formula | C12H12BrNO2S2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 4-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]thiophene-2-carboxamide |
| SMILES | CO[C@H](CNC(=O)c1cc(Br)cs1)c1ccsc1 |
| InChI | InChI=1S/C12H12BrNO2S2/c1-16-10(8-2-3-17-6-8)5-14-12(15)11-4-9(13)7-18-11/h2-4,6-7,10H,5H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | YKEQQHIWWJIYGH-SNVBAGLBSA-N |
| XLogP | 3.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |