C18H15F3N4O3S — CID 122161523
N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide (PubChem CID 122161523) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide.
| Compound Name | N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 122161523 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)-N'-[4-(trifluoromethoxy)phenyl]oxamide |
| SMILES | O=C(NCC(c1ccsc1)n1cccn1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N4O3S/c19-18(20,21)28-14-4-2-13(3-5-14)24-17(27)16(26)22-10-15(12-6-9-29-11-12)25-8-1-7-23-25/h1-9,11,15H,10H2,(H,22,26)(H,24,27) |
| InChIKey | OUEWQSIYNDQJGG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|