C19H21N3O5 — CID 90598990
N-[2-methoxy-2-(2-methylphenyl)ethyl]-N'-(4-methyl-2-nitrophenyl)oxamide (PubChem CID 90598990) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[2-methoxy-2-(2-methylphenyl)ethyl]-N'-(4-methyl-2-nitrophenyl)oxamide.
| Compound Name | N-[2-methoxy-2-(2-methylphenyl)ethyl]-N'-(4-methyl-2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 90598990 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[2-methoxy-2-(2-methylphenyl)ethyl]-N'-(4-methyl-2-nitrophenyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccc(C)cc1[N+](=O)[O-])c1ccccc1C |
| InChI | InChI=1S/C19H21N3O5/c1-12-8-9-15(16(10-12)22(25)26)21-19(24)18(23)20-11-17(27-3)14-7-5-4-6-13(14)2/h4-10,17H,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | AKHZLFLMHZQRQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|