C21H15F5N2O2 — CID 17398533
N-(4-methoxyphenyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide (PubChem CID 17398533) has the molecular formula C21H15F5N2O2 and a molecular weight of 422.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 17398533 |
| Molecular Formula | C21H15F5N2O2 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H15F5N2O2/c1-30-12-8-6-11(7-9-12)28-21(29)13-4-2-3-5-15(13)27-10-14-16(22)18(24)20(26)19(25)17(14)23/h2-9,27H,10H2,1H3,(H,28,29) |
| InChIKey | OTARURLHQMGVFU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|