C20H16F2N2O4S — CID 29425469
2-[(2,6-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide (PubChem CID 29425469) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 2-[(2,6-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 29425469 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-[(2,6-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NS(=O)(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H16F2N2O4S/c1-28-14-11-9-13(10-12-14)23-20(25)15-5-2-3-8-18(15)24-29(26,27)19-16(21)6-4-7-17(19)22/h2-12,24H,1H3,(H,23,25) |
| InChIKey | RUAPECYXCAJUDD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |