C25H20N2O4S — CID 3900171
2-(benzenesulfonamido)-N-(4-phenoxyphenyl)benzamide (PubChem CID 3900171) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3900171 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(4-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O4S/c28-25(26-19-15-17-21(18-16-19)31-20-9-3-1-4-10-20)23-13-7-8-14-24(23)27-32(29,30)22-11-5-2-6-12-22/h1-18,27H,(H,26,28) |
| InChIKey | IYOONMUQXXGBFU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |