C20H19N3O6S2 — CID 30286393
N-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)sulfonylamino]benzamide (PubChem CID 30286393) has the molecular formula C20H19N3O6S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 30286393 |
| Molecular Formula | C20H19N3O6S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NS(=O)(=O)c2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C20H19N3O6S2/c1-29-15-11-9-14(10-12-15)22-20(24)18-7-2-3-8-19(18)23-31(27,28)17-6-4-5-16(13-17)30(21,25)26/h2-13,23H,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | BNJMAFHWLSIOFX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |