C19H16ClN3O5S2 — CID 44898447
2-[(4-chlorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 44898447) has the molecular formula C19H16ClN3O5S2 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 44898447 |
| Molecular Formula | C19H16ClN3O5S2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccccc2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H16ClN3O5S2/c20-13-5-9-16(10-6-13)30(27,28)23-18-4-2-1-3-17(18)19(24)22-14-7-11-15(12-8-14)29(21,25)26/h1-12,23H,(H,22,24)(H2,21,25,26) |
| InChIKey | INUNPUFFPFKXLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |