C21H14ClN3O5S — CID 44898443
2-[(4-chlorophenyl)sulfonylamino]-N-(1,3-dioxoisoindol-5-yl)benzamide (PubChem CID 44898443) has the molecular formula C21H14ClN3O5S and a molecular weight of 455.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(1,3-dioxoisoindol-5-yl)benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(1,3-dioxoisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 44898443 |
| Molecular Formula | C21H14ClN3O5S |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(1,3-dioxoisoindol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14ClN3O5S/c22-12-5-8-14(9-6-12)31(29,30)25-18-4-2-1-3-16(18)20(27)23-13-7-10-15-17(11-13)21(28)24-19(15)26/h1-11,25H,(H,23,27)(H,24,26,28) |
| InChIKey | UAPQYQKCIVPMOC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|