C16H9FN2O4 — CID 58662508
2-fluoro-N-(1,3,4-trioxoisoquinolin-7-yl)benzamide (PubChem CID 58662508) has the molecular formula C16H9FN2O4 and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-fluoro-N-(1,3,4-trioxoisoquinolin-7-yl)benzamide.
| Compound Name | 2-fluoro-N-(1,3,4-trioxoisoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 58662508 |
| Molecular Formula | C16H9FN2O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-fluoro-N-(1,3,4-trioxoisoquinolin-7-yl)benzamide |
| SMILES | O=C1NC(=O)c2cc(NC(=O)c3ccccc3F)ccc2C1=O |
| InChI | InChI=1S/C16H9FN2O4/c17-12-4-2-1-3-10(12)14(21)18-8-5-6-9-11(7-8)15(22)19-16(23)13(9)20/h1-7H,(H,18,21)(H,19,22,23) |
| InChIKey | BUZPDXGWZULIKF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|