C21H12FNO3 — CID 10783699
N-(9,10-dioxophenanthren-3-yl)-2-fluorobenzamide (PubChem CID 10783699) has the molecular formula C21H12FNO3 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-(9,10-dioxophenanthren-3-yl)-2-fluorobenzamide.
| Compound Name | N-(9,10-dioxophenanthren-3-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 10783699 |
| Molecular Formula | C21H12FNO3 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(9,10-dioxophenanthren-3-yl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)-c1ccccc1C(=O)C2=O)c1ccccc1F |
| InChI | InChI=1S/C21H12FNO3/c22-18-8-4-3-7-16(18)21(26)23-12-9-10-15-17(11-12)13-5-1-2-6-14(13)19(24)20(15)25/h1-11H,(H,23,26) |
| InChIKey | CWUWDYQQSBBGHE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|