C19H17FN2O3 — CID 2232250
2-fluoro-N-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]benzamide (PubChem CID 2232250) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]benzamide.
| Compound Name | 2-fluoro-N-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 2232250 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-fluoro-N-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]benzamide |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)c3ccccc3F)cc2C1=O |
| InChI | InChI=1S/C19H17FN2O3/c1-11(2)10-22-18(24)13-8-7-12(9-15(13)19(22)25)21-17(23)14-5-3-4-6-16(14)20/h3-9,11H,10H2,1-2H3,(H,21,23) |
| InChIKey | CTIUPHADXOXJFH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|